 |
|
 |
Description |
 |
|
|
|
|
|
|
|
|
|
ECordyceps polysaccharide
Product Name: ECordyceps polysaccharideCAS: 73-03-0EINECS NO: 73-03-0Molecular formula: C10H13N5O3Molecular weight: 251.24Appearance: White powderPurity: 30%Packing: 25kg/barrelStore in dry, dark and ventilated place.EXW Price: US52/KG Minimum Order 25 Kilogram Supply Ability 300 Ton/Tons per Year Payment Terms: T/T,Western Union,MoneyGram
 Add to Basket
 Web address
|
|
|
Other goods of this manufacturer : |
|
|
|
| |
|
Ethacridine lactate monohydrate
|
|
Ethacridine lactate monohydrate CAS NO:6402-23-9Type: Vitamins, Amino Acids and Coenzymes Meltling point: 243-245℃ Grade Standard: Food Grade,Medicine Grade
|
| |
|
Ethyl 3,4,5-trimethoxybenzoate
|
|
Synonyms 3,4,5-Trimethoxybenzoic Acid Ethyl Ester Molecular Formula C12H16O5 Molecular Weight 240.2524 InChI InChI=1/C12H16O5/c1-5-17-12(13)8-6-9(14-2)11(16-4)10(7-8)15-3/h6-7H,5H2,1-4H
|
|
|
| |
|
flumethasone
|
|
English name: flumethasoneEnglish Synonyms :6-alpha ,9-alpha-difluoro-11-beta ,17-alpha ,21-trihydroxy-16-alpha-methylpregna-1 ,4-diene-3 ,20-dione; 6,9-difluoro-11 ,17,21-trihydroxy-16-methylpregna-1
|
| |
|
flumethasone
|
|
English name: flumethasoneEnglish Synonyms :6-alpha ,9-alpha-difluoro-11-beta ,17-alpha ,21-trihydroxy-16-alpha-methylpregna-1 ,4-diene-3 ,20-dione; 6,9-difluoro-11 ,17,21-trihydroxy-16-methylpregna-1
|
|
|
|
Fosfomycin Calcium
|
|
Molecular Formula: C3H5O4P. Ca Molecular Weight: 176.12 CAS Registry Number: 26472-47-9 EINECS: 247-408-7 Characters: White or almost white powder,slightly solube in water, practic
|
| |
|
Fosfomycin Calcium
|
|
Name: Fosfomycin Calcium Molecular Formula: C3H5O4P. Ca Molecular Weight: 176.12 CAS Registry Number: 26472-47-9 EINECS: 247-408-7 Characters: White or almost white powder,sli
|
| |
|
Furaneol
|
|
FuraneolProduct name: FuraneolCAS: 3658-77-3EINECS: 222-908-8Packing: 1kg/foil bag,25kg/drum,200kg/drumAppearance: White to light yellow crystal or powder solid.
|
|
|
|
| Likewise in category "Chemical Reagents": |
|
|
|
|
|
|
|
|
|
|
|
|
|
help
Add to favorite
Favorite products
