|
|
|
English Name: dihydrojiasmoneEnglish Name: Dihydro-iso-JasmoneCAS NO.: 95-41-0EINECS: 202-417-5Molecular formula: C11H18OMolecular weight or atomic weight: 166.27Density: 0.9201 (15 ℃, [1])Boiling p
|
| |
|
|
English Name: CARBONIC ACID DIMETHYL ESTER; DMC; METHYL CARBONATE; CH3OCOOCH3 Dimethyl ester; of carbonic acid; Methyl carbonate ((MeO) 2CO); methylcarbonate ((MEO) 2CO); Dimetyl carbonate; DIMETHYL C
|
| |
|
|
English synonyms: (1,2-Dihydroxy-3-propyl) thiophyllin (2,3-Dihydroxypropyl); 1,3-Dimethyl-7- xanthine; 1H-Purine-2,6-dione, 7- (2,3-Dihydroxypropyl) -3,7-dihydro-1,3-dimethyl-; 1h-purine-2,6-dione, 7
|
|
|
|
|
English name: DutasterideEnglish Synonyms: (5alpha, 17beta)-n-{2,5-bis (trifluoromethyl) phenyl}-3-oxo-4-azaandrost-l-ene-17-carboxamide; DUTASTERIDE; GG-745, GI-198745,; 5α, 17β)-N-[2,5-Bi
|
| |
|
|
Product Name: ECordyceps polysaccharideCAS: 73-03-0EINECS NO: 73-03-0Molecular formula: C10H13N5O3Molecular weight: 251.24Appearance: White powderPurity: 30%Packing: 25kg/barrelStore in dry, dark and
|
| |
|
|
Offering Sodium Isethionate.- Molecular formula: C2H5O4SNa - Structural formula: HO-CH2- CH2-SO3Na - CAS No. 1562-00-1- Specifications: 98 solid or 60%solution - Packing: 25kg net per f
|
|
|
|
|
Ethacridine lactate monohydrate CAS NO:6402-23-9Type: Vitamins, Amino Acids and Coenzymes Meltling point: 243-245℃ Grade Standard: Food Grade,Medicine Grade
|
| |
|
|
Synonyms 3,4,5-Trimethoxybenzoic Acid Ethyl Ester Molecular Formula C12H16O5 Molecular Weight 240.2524 InChI InChI=1/C12H16O5/c1-5-17-12(13)8-6-9(14-2)11(16-4)10(7-8)15-3/h6-7H,5H2,1-4H
|
| |
|
|
Ethyl acetate extract of silymarinProduct name:Ethyl acetate extract of silymarinPacking: 25kg/drumAssay: 80%
|
|